C15H22O — CID 6481134
(2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaen-1-ol (PubChem CID 6481134) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaen-1-ol.
| Compound Name | (2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaen-1-ol |
|---|---|
| PubChem CID | 6481134 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaen-1-ol |
| SMILES | CC(C)=C/C=C/C(C)=C/C=C/C(C)=C/CO |
| InChI | InChI=1S/C15H22O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h5-11,16H,12H2,1-4H3/b8-5+,10-6+,14-9+,15-11+ |
| InChIKey | XOKHQCCKAMDRCN-BZCYSDSTSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|