C15H24S — CID 6481138
(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienethial (PubChem CID 6481138) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienethial.
| Compound Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienethial |
|---|---|
| PubChem CID | 6481138 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienethial |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=S |
| InChI | InChI=1S/C15H24S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| InChIKey | JHQDMBMARDTEBF-YFVJMOTDSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|