About 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol (PubChem CID 64811494) has the molecular formula C9H16ClN3O
and a molecular weight of 217.70 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol.
Molecular Properties
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol |
| PubChem CID | 64811494 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol |
| SMILES | CNC(CO)Cn1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C9H16ClN3O/c1-6-9(10)7(2)13(12-6)4-8(5-14)11-3/h8,11,14H,4-5H2,1-3H3 |
| InChIKey | ZGHAHINEKIGOCM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol?
The IUPAC name of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol (CID 64811494) is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol.
What is the SMILES notation for 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol?
The canonical SMILES for 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol is CNC(CO)Cn1nc(C)c(Cl)c1C.
What is the InChIKey of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol?
The InChIKey is ZGHAHINEKIGOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3O/c1-6-9(10)7(2)13(12-6)4-8(5-14)11-3/h8,11,14H,4-5H2,1-3H3.
What are the key properties of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol?
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol has a molecular weight of 217.70 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(methylamino)propan-1-ol is sourced from PubChem (CID 64811494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).