About 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole
1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole (PubChem CID 6481247) has the molecular formula C22H19Cl2N3
and a molecular weight of 396.32 g/mol. Its IUPAC name is 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole.
Molecular Properties
| Compound Name | 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole |
| PubChem CID | 6481247 |
| Molecular Formula | C22H19Cl2N3 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole |
| SMILES | CCn1cc(-c2ccc(Cl)cc2Cl)c(C(c2ccccc2)n2ccnc2)c1 |
| InChI | InChI=1S/C22H19Cl2N3/c1-2-26-13-19(18-9-8-17(23)12-21(18)24)20(14-26)22(27-11-10-25-15-27)16-6-4-3-5-7-16/h3-15,22H,2H2,1H3 |
| InChIKey | CYONRLZAGZQLEC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole?
The IUPAC name of 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole (CID 6481247) is 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole.
What is the SMILES notation for 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole?
The canonical SMILES for 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole is CCn1cc(-c2ccc(Cl)cc2Cl)c(C(c2ccccc2)n2ccnc2)c1.
What is the InChIKey of 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole?
The InChIKey is CYONRLZAGZQLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl2N3/c1-2-26-13-19(18-9-8-17(23)12-21(18)24)20(14-26)22(27-11-10-25-15-27)16-6-4-3-5-7-16/h3-15,22H,2H2,1H3.
What are the key properties of 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole?
1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole has a molecular weight of 396.32 g/mol, XLogP of 6.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(2,4-dichlorophenyl)-1-ethylpyrrol-3-yl]-phenylmethyl]imidazole is sourced from PubChem (CID 6481247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).