C17H11FO3S — CID 6481307
2-(3-fluorophenyl)sulfanyl-8-methoxynaphthalene-1,4-dione (PubChem CID 6481307) has the molecular formula C17H11FO3S and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-(3-fluorophenyl)sulfanyl-8-methoxynaphthalene-1,4-dione.
| Compound Name | 2-(3-fluorophenyl)sulfanyl-8-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 6481307 |
| Molecular Formula | C17H11FO3S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-(3-fluorophenyl)sulfanyl-8-methoxynaphthalene-1,4-dione |
| SMILES | COc1cccc2c1C(=O)C(Sc1cccc(F)c1)=CC2=O |
| InChI | InChI=1S/C17H11FO3S/c1-21-14-7-3-6-12-13(19)9-15(17(20)16(12)14)22-11-5-2-4-10(18)8-11/h2-9H,1H3 |
| InChIKey | JTSQPWDQRREAKV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|