C21H20N4O3 — CID 6481410
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(1H-indazol-3-yl)ethane-1,2-dione (PubChem CID 6481410) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(1H-indazol-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(1H-indazol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 6481410 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(1H-indazol-3-yl)ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20N4O3/c1-14-13-24(20(27)15-7-3-2-4-8-15)11-12-25(14)21(28)19(26)18-16-9-5-6-10-17(16)22-23-18/h2-10,14H,11-13H2,1H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | KOJHYURREGJDOX-CQSZACIVSA-N |
| XLogP | 2.12 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|