About 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol
3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol (PubChem CID 64814500) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol |
| PubChem CID | 64814500 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol |
| SMILES | Cc1nn(C)c(C)c1C(N)CCO |
| InChI | InChI=1S/C9H17N3O/c1-6-9(8(10)4-5-13)7(2)12(3)11-6/h8,13H,4-5,10H2,1-3H3 |
| InChIKey | GKCBZHRWAUYXLC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol?
The IUPAC name of 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol (CID 64814500) is 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol.
What is the SMILES notation for 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol?
The canonical SMILES for 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol is Cc1nn(C)c(C)c1C(N)CCO.
What is the InChIKey of 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol?
The InChIKey is GKCBZHRWAUYXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-6-9(8(10)4-5-13)7(2)12(3)11-6/h8,13H,4-5,10H2,1-3H3.
What are the key properties of 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol?
3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol has a molecular weight of 183.25 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-ol is sourced from PubChem (CID 64814500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).