benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate

C16H20N2O3S — CID 6481460

IUPACbenzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate
SMILESO=C(C1CCCN1C(=O)OCc1ccccc1)N1CCSC1
InChIInChI=1S/C16H20N2O3S/c19-15(17-9-10-22-12-17)14-7-4-8-18(14)16(20)21-11-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2
InChIKeyUJBOEHNGHKEEQC-UHFFFAOYSA-N
MW320.41 g/mol
LogP2.32
Rot. Bonds3

About benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate

benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 6481460) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate
PubChem CID6481460
Molecular FormulaC16H20N2O3S
Molecular Weight320.41 g/mol
Exact Mass320.12
IUPAC Namebenzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate
SMILESO=C(C1CCCN1C(=O)OCc1ccccc1)N1CCSC1
InChIInChI=1S/C16H20N2O3S/c19-15(17-9-10-22-12-17)14-7-4-8-18(14)16(20)21-11-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2
InChIKeyUJBOEHNGHKEEQC-UHFFFAOYSA-N
XLogP2.32
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.41
LogP ≤ 52.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate (CID 6481460) is benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate is O=C(C1CCCN1C(=O)OCc1ccccc1)N1CCSC1.
What is the InChIKey of benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
The InChIKey is UJBOEHNGHKEEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3S/c19-15(17-9-10-22-12-17)14-7-4-8-18(14)16(20)21-11-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2.
What are the key properties of benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate?
benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate has a molecular weight of 320.41 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1,3-thiazolidine-3-carbonyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 6481460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).