C10H10F5NO2 — CID 64814642
1-amino-4-(2,3,4,5,6-pentafluorophenoxy)butan-2-ol (PubChem CID 64814642) has the molecular formula C10H10F5NO2 and a molecular weight of 271.18 g/mol. Its IUPAC name is 1-amino-4-(2,3,4,5,6-pentafluorophenoxy)butan-2-ol.
| Compound Name | 1-amino-4-(2,3,4,5,6-pentafluorophenoxy)butan-2-ol |
|---|---|
| PubChem CID | 64814642 |
| Molecular Formula | C10H10F5NO2 |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-amino-4-(2,3,4,5,6-pentafluorophenoxy)butan-2-ol |
| SMILES | NCC(O)CCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5NO2/c11-5-6(12)8(14)10(9(15)7(5)13)18-2-1-4(17)3-16/h4,17H,1-3,16H2 |
| InChIKey | WDEDZWQFUDPMPZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|