About 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine
2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine (PubChem CID 64815854) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine |
| PubChem CID | 64815854 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine |
| SMILES | Cn1cnnc1C1CCCC1N |
| InChI | InChI=1S/C8H14N4/c1-12-5-10-11-8(12)6-3-2-4-7(6)9/h5-7H,2-4,9H2,1H3 |
| InChIKey | HTZYLVODXWNXIN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
The IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine (CID 64815854) is 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine.
What is the SMILES notation for 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
The canonical SMILES for 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine is Cn1cnnc1C1CCCC1N.
What is the InChIKey of 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
The InChIKey is HTZYLVODXWNXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-12-5-10-11-8(12)6-3-2-4-7(6)9/h5-7H,2-4,9H2,1H3.
What are the key properties of 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine?
2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine has a molecular weight of 166.23 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-amine is sourced from PubChem (CID 64815854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).