About 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone
1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone (PubChem CID 6481656) has the molecular formula C7H12N2OS2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone.
Molecular Properties
| Compound Name | 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone |
| PubChem CID | 6481656 |
| Molecular Formula | C7H12N2OS2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone |
| SMILES | O=C(C1CSCN1)N1CCSC1 |
| InChI | InChI=1S/C7H12N2OS2/c10-7(6-3-12-4-8-6)9-1-2-11-5-9/h6,8H,1-5H2 |
| InChIKey | QAKMVSQDMSDINT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone?
The IUPAC name of 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone (CID 6481656) is 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone.
What is the SMILES notation for 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone?
The canonical SMILES for 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone is O=C(C1CSCN1)N1CCSC1.
What is the InChIKey of 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone?
The InChIKey is QAKMVSQDMSDINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS2/c10-7(6-3-12-4-8-6)9-1-2-11-5-9/h6,8H,1-5H2.
What are the key properties of 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone?
1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone has a molecular weight of 204.32 g/mol, XLogP of 0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazolidin-3-yl(1,3-thiazolidin-4-yl)methanone is sourced from PubChem (CID 6481656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).