C9H10F8N2O2 — CID 648167
2,2,3,3-tetrafluoro-N-[3-(2,2,3,3-tetrafluoropropanoylamino)propyl]propanamide (PubChem CID 648167) has the molecular formula C9H10F8N2O2 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[3-(2,2,3,3-tetrafluoropropanoylamino)propyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[3-(2,2,3,3-tetrafluoropropanoylamino)propyl]propanamide |
|---|---|
| PubChem CID | 648167 |
| Molecular Formula | C9H10F8N2O2 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[3-(2,2,3,3-tetrafluoropropanoylamino)propyl]propanamide |
| SMILES | O=C(NCCCNC(=O)C(F)(F)C(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H10F8N2O2/c10-4(11)8(14,15)6(20)18-2-1-3-19-7(21)9(16,17)5(12)13/h4-5H,1-3H2,(H,18,20)(H,19,21) |
| InChIKey | HQOVLDVKWYLXLQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|