C16H22N2O3 — CID 64817499
2-[[methyl-[(2-methylphenyl)methyl]carbamoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 64817499) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[[methyl-[(2-methylphenyl)methyl]carbamoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[methyl-[(2-methylphenyl)methyl]carbamoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 64817499 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[[methyl-[(2-methylphenyl)methyl]carbamoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccccc1CN(C)C(=O)NC1CCCC1C(=O)O |
| InChI | InChI=1S/C16H22N2O3/c1-11-6-3-4-7-12(11)10-18(2)16(21)17-14-9-5-8-13(14)15(19)20/h3-4,6-7,13-14H,5,8-10H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | YGBMDWXUSMSCKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |