About 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol
1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol (PubChem CID 64818459) has the molecular formula C11H26N2O
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol |
| PubChem CID | 64818459 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol |
| SMILES | CN(CCC(C)(O)CN)CC(C)(C)C |
| InChI | InChI=1S/C11H26N2O/c1-10(2,3)9-13(5)7-6-11(4,14)8-12/h14H,6-9,12H2,1-5H3 |
| InChIKey | YVQIHKXDFIDMQW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol?
The IUPAC name of 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol (CID 64818459) is 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol.
What is the SMILES notation for 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol?
The canonical SMILES for 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol is CN(CCC(C)(O)CN)CC(C)(C)C.
What is the InChIKey of 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol?
The InChIKey is YVQIHKXDFIDMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O/c1-10(2,3)9-13(5)7-6-11(4,14)8-12/h14H,6-9,12H2,1-5H3.
What are the key properties of 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol?
1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol has a molecular weight of 202.34 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-[2,2-dimethylpropyl(methyl)amino]-2-methylbutan-2-ol is sourced from PubChem (CID 64818459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).