About 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol
1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol (PubChem CID 64818490) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol.
Molecular Properties
| Compound Name | 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol |
| PubChem CID | 64818490 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol |
| SMILES | CC(CC(C)(O)CN)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H28N2O/c1-11(9-13(4,16)10-14)15-7-5-12(2,3)6-8-15/h11,16H,5-10,14H2,1-4H3 |
| InChIKey | JAOWEJCDYIROHJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol?
The IUPAC name of 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol (CID 64818490) is 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol.
What is the SMILES notation for 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol?
The canonical SMILES for 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol is CC(CC(C)(O)CN)N1CCC(C)(C)CC1.
What is the InChIKey of 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol?
The InChIKey is JAOWEJCDYIROHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-11(9-13(4,16)10-14)15-7-5-12(2,3)6-8-15/h11,16H,5-10,14H2,1-4H3.
What are the key properties of 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol?
1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol has a molecular weight of 228.38 g/mol, XLogP of 1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-(4,4-dimethylpiperidin-1-yl)-2-methylpentan-2-ol is sourced from PubChem (CID 64818490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).