C14H28N2O2 — CID 64819113
6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-amino-2-methylhexan-2-ol (PubChem CID 64819113) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-amino-2-methylhexan-2-ol.
| Compound Name | 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-amino-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 64819113 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-amino-2-methylhexan-2-ol |
| SMILES | CC(O)(CN)CCCCN1CCOC2CCCC21 |
| InChI | InChI=1S/C14H28N2O2/c1-14(17,11-15)7-2-3-8-16-9-10-18-13-6-4-5-12(13)16/h12-13,17H,2-11,15H2,1H3 |
| InChIKey | NXPPEAYCPORBSF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|