C14H30N2O — CID 64819128
1-amino-4-[cyclohexylmethyl(methyl)amino]-2-methylpentan-2-ol (PubChem CID 64819128) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-amino-4-[cyclohexylmethyl(methyl)amino]-2-methylpentan-2-ol.
| Compound Name | 1-amino-4-[cyclohexylmethyl(methyl)amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 64819128 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-amino-4-[cyclohexylmethyl(methyl)amino]-2-methylpentan-2-ol |
| SMILES | CC(CC(C)(O)CN)N(C)CC1CCCCC1 |
| InChI | InChI=1S/C14H30N2O/c1-12(9-14(2,17)11-15)16(3)10-13-7-5-4-6-8-13/h12-13,17H,4-11,15H2,1-3H3 |
| InChIKey | PGACKHMAMDFUCP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |