About 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol
1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol (PubChem CID 64819543) has the molecular formula C12H26N2O3S
and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol.
Molecular Properties
| Compound Name | 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol |
| PubChem CID | 64819543 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol |
| SMILES | CN(CCCCC(C)(O)CN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-12(15,10-13)6-3-4-7-14(2)11-5-8-18(16,17)9-11/h11,15H,3-10,13H2,1-2H3 |
| InChIKey | RZFRKYZTKWVXMD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol?
The IUPAC name of 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol (CID 64819543) is 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol.
What is the SMILES notation for 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol?
The canonical SMILES for 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol is CN(CCCCC(C)(O)CN)C1CCS(=O)(=O)C1.
What is the InChIKey of 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol?
The InChIKey is RZFRKYZTKWVXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O3S/c1-12(15,10-13)6-3-4-7-14(2)11-5-8-18(16,17)9-11/h11,15H,3-10,13H2,1-2H3.
What are the key properties of 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol?
1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol has a molecular weight of 278.42 g/mol, XLogP of -0.01, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-6-[(1,1-dioxothiolan-3-yl)-methylamino]-2-methylhexan-2-ol is sourced from PubChem (CID 64819543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).