C14H22BrNOS — CID 64819935
5-(2-bromophenyl)sulfanyl-2-(ethylamino)-2-methylpentan-1-ol (PubChem CID 64819935) has the molecular formula C14H22BrNOS and a molecular weight of 332.31 g/mol. Its IUPAC name is 5-(2-bromophenyl)sulfanyl-2-(ethylamino)-2-methylpentan-1-ol.
| Compound Name | 5-(2-bromophenyl)sulfanyl-2-(ethylamino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 64819935 |
| Molecular Formula | C14H22BrNOS |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 5-(2-bromophenyl)sulfanyl-2-(ethylamino)-2-methylpentan-1-ol |
| SMILES | CCNC(C)(CO)CCCSc1ccccc1Br |
| InChI | InChI=1S/C14H22BrNOS/c1-3-16-14(2,11-17)9-6-10-18-13-8-5-4-7-12(13)15/h4-5,7-8,16-17H,3,6,9-11H2,1-2H3 |
| InChIKey | JLKHWJUUOMSNKZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|