C28H49NO2 — CID 6482030
(4E,8E)-11-(1,3-dimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)-N,4,9-trimethyl-N-(4-methylpentyl)undeca-4,8-dien-1-amine oxide (PubChem CID 6482030) has the molecular formula C28H49NO2 and a molecular weight of 431.71 g/mol. Its IUPAC name is (4E,8E)-11-(1,3-dimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)-N,4,9-trimethyl-N-(4-methylpentyl)undeca-4,8-dien-1-amine oxide.
| Compound Name | (4E,8E)-11-(1,3-dimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)-N,4,9-trimethyl-N-(4-methylpentyl)undeca-4,8-dien-1-amine oxide |
|---|---|
| PubChem CID | 6482030 |
| Molecular Formula | C28H49NO2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.38 |
| IUPAC Name | (4E,8E)-11-(1,3-dimethyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)-N,4,9-trimethyl-N-(4-methylpentyl)undeca-4,8-dien-1-amine oxide |
| SMILES | CC1=C(CC/C(C)=C/CC/C=C(\C)CCC[N+](C)([O-])CCCC(C)C)C2(C)OC2CC1 |
| InChI | InChI=1S/C28H49NO2/c1-22(2)12-10-20-29(7,30)21-11-15-23(3)13-8-9-14-24(4)16-18-26-25(5)17-19-27-28(26,6)31-27/h13-14,22,27H,8-12,15-21H2,1-7H3/b23-13+,24-14+ |
| InChIKey | YOOHAHHKZXCWFC-RNIAWFEPSA-N |
| XLogP | 7.87 |
| TPSA | 35.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|