C13H23NOS2 — CID 64820619
2-methyl-2-(propan-2-ylamino)-5-thiophen-2-ylsulfanylpentan-1-ol (PubChem CID 64820619) has the molecular formula C13H23NOS2 and a molecular weight of 273.47 g/mol. Its IUPAC name is 2-methyl-2-(propan-2-ylamino)-5-thiophen-2-ylsulfanylpentan-1-ol.
| Compound Name | 2-methyl-2-(propan-2-ylamino)-5-thiophen-2-ylsulfanylpentan-1-ol |
|---|---|
| PubChem CID | 64820619 |
| Molecular Formula | C13H23NOS2 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-methyl-2-(propan-2-ylamino)-5-thiophen-2-ylsulfanylpentan-1-ol |
| SMILES | CC(C)NC(C)(CO)CCCSc1cccs1 |
| InChI | InChI=1S/C13H23NOS2/c1-11(2)14-13(3,10-15)7-5-9-17-12-6-4-8-16-12/h4,6,8,11,14-15H,5,7,9-10H2,1-3H3 |
| InChIKey | GFHXBUOUTNILAC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|