About 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol
1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 64821649) has the molecular formula C8H16N4O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol.
Analyze 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol?
The IUPAC name of 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol (CID 64821649) is 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol.
What is the SMILES notation for 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol?
The canonical SMILES for 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol is Cc1nc(C)n(CCC(O)CN)n1.
What is the InChIKey of 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol?
The InChIKey is FDKQLNHTCFJLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O/c1-6-10-7(2)12(11-6)4-3-8(13)5-9/h8,13H,3-5,9H2,1-2H3.
What are the key properties of 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol?
1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol has a molecular weight of 184.24 g/mol, XLogP of -0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-(3,5-dimethyl-1,2,4-triazol-1-yl)butan-2-ol is sourced from PubChem (CID 64821649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).