About N-decylsulfonylacetamide
N-decylsulfonylacetamide (PubChem CID 6482235) has the molecular formula C12H25NO3S
and a molecular weight of 263.40 g/mol. Its IUPAC name is N-decylsulfonylacetamide.
Molecular Properties
| Compound Name | N-decylsulfonylacetamide |
| PubChem CID | 6482235 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-decylsulfonylacetamide |
| SMILES | CCCCCCCCCCS(=O)(=O)NC(C)=O |
| InChI | InChI=1S/C12H25NO3S/c1-3-4-5-6-7-8-9-10-11-17(15,16)13-12(2)14/h3-11H2,1-2H3,(H,13,14) |
| InChIKey | NXFTWUNZUSCGKR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decylsulfonylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decylsulfonylacetamide?
The IUPAC name of N-decylsulfonylacetamide (CID 6482235) is N-decylsulfonylacetamide.
What is the SMILES notation for N-decylsulfonylacetamide?
The canonical SMILES for N-decylsulfonylacetamide is CCCCCCCCCCS(=O)(=O)NC(C)=O.
What is the InChIKey of N-decylsulfonylacetamide?
The InChIKey is NXFTWUNZUSCGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3S/c1-3-4-5-6-7-8-9-10-11-17(15,16)13-12(2)14/h3-11H2,1-2H3,(H,13,14).
What are the key properties of N-decylsulfonylacetamide?
N-decylsulfonylacetamide has a molecular weight of 263.40 g/mol, XLogP of 2.59, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-decylsulfonylacetamide is sourced from PubChem (CID 6482235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).