C22H19N3 — CID 6482257
3-(1H-imidazol-5-yl)-N-[(4-phenylphenyl)methyl]aniline (PubChem CID 6482257) has the molecular formula C22H19N3 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-N-[(4-phenylphenyl)methyl]aniline.
| Compound Name | 3-(1H-imidazol-5-yl)-N-[(4-phenylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 6482257 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-N-[(4-phenylphenyl)methyl]aniline |
| SMILES | c1ccc(-c2ccc(CNc3cccc(-c4cnc[nH]4)c3)cc2)cc1 |
| InChI | InChI=1S/C22H19N3/c1-2-5-18(6-3-1)19-11-9-17(10-12-19)14-24-21-8-4-7-20(13-21)22-15-23-16-25-22/h1-13,15-16,24H,14H2,(H,23,25) |
| InChIKey | MMEFELOIMGMTFW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |