C15H20FN3O2 — CID 64822591
N-(3-acetamido-4-fluorophenyl)-2-aminocyclohexane-1-carboxamide (PubChem CID 64822591) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-2-aminocyclohexane-1-carboxamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-2-aminocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64822591 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-2-aminocyclohexane-1-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)C2CCCCC2N)ccc1F |
| InChI | InChI=1S/C15H20FN3O2/c1-9(20)18-14-8-10(6-7-12(14)16)19-15(21)11-4-2-3-5-13(11)17/h6-8,11,13H,2-5,17H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | DXKRFXJHUJPCJN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |