C21H40N2 — CID 6482263
N'-(2,3-dimethylcyclohexyl)-N-[[(1S,2R,3S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]methyl]ethane-1,2-diamine (PubChem CID 6482263) has the molecular formula C21H40N2 and a molecular weight of 320.57 g/mol. Its IUPAC name is N'-(2,3-dimethylcyclohexyl)-N-[[(1S,2R,3S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-(2,3-dimethylcyclohexyl)-N-[[(1S,2R,3S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 6482263 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | N'-(2,3-dimethylcyclohexyl)-N-[[(1S,2R,3S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]methyl]ethane-1,2-diamine |
| SMILES | CC1CCCC(NCCNC[C@@H]2[C@@H](C)C[C@H]3C[C@@H]2C3(C)C)C1C |
| InChI | InChI=1S/C21H40N2/c1-14-7-6-8-20(16(14)3)23-10-9-22-13-18-15(2)11-17-12-19(18)21(17,4)5/h14-20,22-23H,6-13H2,1-5H3/t14?,15-,16?,17-,18+,19-,20?/m0/s1 |
| InChIKey | DWBGFFTUCQPUGK-MJUDTQNSSA-N |
| XLogP | 4.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|