C19H36N2 — CID 6482270
N'-[(1S)-1-cyclohexylethyl]-N-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine (PubChem CID 6482270) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N'-[(1S)-1-cyclohexylethyl]-N-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine.
| Compound Name | N'-[(1S)-1-cyclohexylethyl]-N-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 6482270 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N'-[(1S)-1-cyclohexylethyl]-N-[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]ethane-1,2-diamine |
| SMILES | C[C@H](NCCN[C@@H]1CC[C@H]2C[C@@H]1C2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C19H36N2/c1-14(15-7-5-4-6-8-15)20-11-12-21-18-10-9-16-13-17(18)19(16,2)3/h14-18,20-21H,4-13H2,1-3H3/t14-,16-,17-,18+/m0/s1 |
| InChIKey | AQRCEJIXOKKNIV-LEUOFYLZSA-N |
| XLogP | 3.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|