C20H36N2 — CID 6482275
N'-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-prop-2-enylethane-1,2-diamine (PubChem CID 6482275) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N'-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 6482275 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N'-cyclopentyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCN(CCNC/C=C(\C)CCC=C(C)C)C1CCCC1 |
| InChI | InChI=1S/C20H36N2/c1-5-16-22(20-11-6-7-12-20)17-15-21-14-13-19(4)10-8-9-18(2)3/h5,9,13,20-21H,1,6-8,10-12,14-17H2,2-4H3/b19-13+ |
| InChIKey | PVPUCBTYLHHNMK-CPNJWEJPSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|