C15H20N2O3 — CID 64822923
methyl 2-[(2-aminocyclohexanecarbonyl)amino]benzoate (PubChem CID 64822923) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 2-[(2-aminocyclohexanecarbonyl)amino]benzoate.
| Compound Name | methyl 2-[(2-aminocyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 64822923 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl 2-[(2-aminocyclohexanecarbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCCCC1N |
| InChI | InChI=1S/C15H20N2O3/c1-20-15(19)11-7-3-5-9-13(11)17-14(18)10-6-2-4-8-12(10)16/h3,5,7,9-10,12H,2,4,6,8,16H2,1H3,(H,17,18) |
| InChIKey | HTUHEJALZYABTM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |