C28H28FN3O5 — CID 6482308
N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobutanamide (PubChem CID 6482308) has the molecular formula C28H28FN3O5 and a molecular weight of 505.55 g/mol. Its IUPAC name is N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobutanamide.
| Compound Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 6482308 |
| Molecular Formula | C28H28FN3O5 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc2ccccc2c1)NC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C28H28FN3O5/c29-24-16-22(7-8-25(24)31-11-13-36-14-12-31)32-18-23(37-28(32)35)17-30-27(34)10-9-26(33)21-6-5-19-3-1-2-4-20(19)15-21/h1-8,15-16,23H,9-14,17-18H2,(H,30,34)/t23-/m0/s1 |
| InChIKey | DTEJAUFQHTYBCK-QHCPKHFHSA-N |
| XLogP | 3.92 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|