C30H44O4 — CID 6482366
5-hydroxy-2,2,6,6-tetrakis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione (PubChem CID 6482366) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 5-hydroxy-2,2,6,6-tetrakis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione.
| Compound Name | 5-hydroxy-2,2,6,6-tetrakis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 6482366 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 5-hydroxy-2,2,6,6-tetrakis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)C(C(=O)C(C)C)=C(O)C(CC=C(C)C)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C30H44O4/c1-19(2)11-15-29(16-12-20(3)4)26(32)24(25(31)23(9)10)27(33)30(28(29)34,17-13-21(5)6)18-14-22(7)8/h11-14,23,32H,15-18H2,1-10H3 |
| InChIKey | KPPHPIMYCLGAER-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|