C36H55N5O9 — CID 6482453
(2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]heptanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid (PubChem CID 6482453) has the molecular formula C36H55N5O9 and a molecular weight of 701.86 g/mol. Its IUPAC name is (2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]heptanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]heptanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 6482453 |
| Molecular Formula | C36H55N5O9 |
| Molecular Weight | 701.86 g/mol |
| Exact Mass | 701.40 |
| IUPAC Name | (2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]heptanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
| SMILES | CCCCC[C@H](NC(=O)[C@@H](NC(=O)OCC(C)C)C1CCCCC1)C(=O)NC(CCC)C(=O)C(=O)NCC(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C36H55N5O9/c1-5-7-10-20-27(39-33(45)29(24-16-11-8-12-17-24)41-36(49)50-22-23(3)4)32(44)38-26(15-6-2)31(43)34(46)37-21-28(42)40-30(35(47)48)25-18-13-9-14-19-25/h9,13-14,18-19,23-24,26-27,29-30H,5-8,10-12,15-17,20-22H2,1-4H3,(H,37,46)(H,38,44)(H,39,45)(H,40,42)(H,41,49)(H,47,48)/t26?,27-,29-,30-/m0/s1 |
| InChIKey | PVQNEPRTDDNIEP-AGDVDVTHSA-N |
| XLogP | 3.29 |
| TPSA | 209.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|