C23H33N5O7S2 — CID 648251
4-[4-[4-ethyl-5-(2-piperidin-1-ylethylsulfanyl)-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine;oxalic acid (PubChem CID 648251) has the molecular formula C23H33N5O7S2 and a molecular weight of 555.68 g/mol. Its IUPAC name is 4-[4-[4-ethyl-5-(2-piperidin-1-ylethylsulfanyl)-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine;oxalic acid.
| Compound Name | 4-[4-[4-ethyl-5-(2-piperidin-1-ylethylsulfanyl)-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine;oxalic acid |
|---|---|
| PubChem CID | 648251 |
| Molecular Formula | C23H33N5O7S2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 4-[4-[4-ethyl-5-(2-piperidin-1-ylethylsulfanyl)-1,2,4-triazol-3-yl]phenyl]sulfonylmorpholine;oxalic acid |
| SMILES | CCn1c(SCCN2CCCCC2)nnc1-c1ccc(S(=O)(=O)N2CCOCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H31N5O3S2.C2H2O4/c1-2-26-20(22-23-21(26)30-17-14-24-10-4-3-5-11-24)18-6-8-19(9-7-18)31(27,28)25-12-15-29-16-13-25;3-1(4)2(5)6/h6-9H,2-5,10-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ROPFEMLYMGVQRN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|