About cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone
cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone (PubChem CID 6482542) has the molecular formula C17H14Cl2O2
and a molecular weight of 321.20 g/mol. Its IUPAC name is cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone |
| PubChem CID | 6482542 |
| Molecular Formula | C17H14Cl2O2 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C1CC1 |
| InChI | InChI=1S/C17H14Cl2O2/c18-15-8-1-11(9-16(15)19)10-21-14-6-4-13(5-7-14)17(20)12-2-3-12/h1,4-9,12H,2-3,10H2 |
| InChIKey | UGEYTIIEQRDJTH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone?
The IUPAC name of cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone (CID 6482542) is cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone.
What is the SMILES notation for cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone?
The canonical SMILES for cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone is O=C(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C1CC1.
What is the InChIKey of cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone?
The InChIKey is UGEYTIIEQRDJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2O2/c18-15-8-1-11(9-16(15)19)10-21-14-6-4-13(5-7-14)17(20)12-2-3-12/h1,4-9,12H,2-3,10H2.
What are the key properties of cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone?
cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone has a molecular weight of 321.20 g/mol, XLogP of 5.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methanone is sourced from PubChem (CID 6482542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).