About 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol
2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol (PubChem CID 64825685) has the molecular formula C11H21F3N2O
and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol |
| PubChem CID | 64825685 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol |
| SMILES | CCN(CC(F)(F)F)CC(CO)(NC)C1CC1 |
| InChI | InChI=1S/C11H21F3N2O/c1-3-16(7-11(12,13)14)6-10(8-17,15-2)9-4-5-9/h9,15,17H,3-8H2,1-2H3 |
| InChIKey | RZBQHIPAPSGFIW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol?
The IUPAC name of 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol (CID 64825685) is 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol.
What is the SMILES notation for 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol?
The canonical SMILES for 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol is CCN(CC(F)(F)F)CC(CO)(NC)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol?
The InChIKey is RZBQHIPAPSGFIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2O/c1-3-16(7-11(12,13)14)6-10(8-17,15-2)9-4-5-9/h9,15,17H,3-8H2,1-2H3.
What are the key properties of 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol?
2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol has a molecular weight of 254.30 g/mol, XLogP of 1.23, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-[ethyl(2,2,2-trifluoroethyl)amino]-2-(methylamino)propan-1-ol is sourced from PubChem (CID 64825685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).