About 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole
4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 6482601) has the molecular formula C18H25ClN2O2
and a molecular weight of 336.86 g/mol. Its IUPAC name is 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 6482601 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | COc1ccc(OCCCCCCc2c(C)n[nH]c2C)c(Cl)c1 |
| InChI | InChI=1S/C18H25ClN2O2/c1-13-16(14(2)21-20-13)8-6-4-5-7-11-23-18-10-9-15(22-3)12-17(18)19/h9-10,12H,4-8,11H2,1-3H3,(H,20,21) |
| InChIKey | HZQYWRRDSRGONY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole (CID 6482601) is 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole is COc1ccc(OCCCCCCc2c(C)n[nH]c2C)c(Cl)c1.
What is the InChIKey of 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole?
The InChIKey is HZQYWRRDSRGONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2O2/c1-13-16(14(2)21-20-13)8-6-4-5-7-11-23-18-10-9-15(22-3)12-17(18)19/h9-10,12H,4-8,11H2,1-3H3,(H,20,21).
What are the key properties of 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole?
4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole has a molecular weight of 336.86 g/mol, XLogP of 4.87, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(2-chloro-4-methoxyphenoxy)hexyl]-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 6482601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).