About 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol
3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol (PubChem CID 6482622) has the molecular formula C19H27ClN2O2
and a molecular weight of 350.89 g/mol. Its IUPAC name is 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol.
Molecular Properties
| Compound Name | 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol |
| PubChem CID | 6482622 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol |
| SMILES | CCc1n[nH]c(CC)c1CCCCCCOc1ccc(O)cc1Cl |
| InChI | InChI=1S/C19H27ClN2O2/c1-3-17-15(18(4-2)22-21-17)9-7-5-6-8-12-24-19-11-10-14(23)13-16(19)20/h10-11,13,23H,3-9,12H2,1-2H3,(H,21,22) |
| InChIKey | JXVLDKLKUMGCNK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol?
The IUPAC name of 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol (CID 6482622) is 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol.
What is the SMILES notation for 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol?
The canonical SMILES for 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol is CCc1n[nH]c(CC)c1CCCCCCOc1ccc(O)cc1Cl.
What is the InChIKey of 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol?
The InChIKey is JXVLDKLKUMGCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClN2O2/c1-3-17-15(18(4-2)22-21-17)9-7-5-6-8-12-24-19-11-10-14(23)13-16(19)20/h10-11,13,23H,3-9,12H2,1-2H3,(H,21,22).
What are the key properties of 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol?
3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol has a molecular weight of 350.89 g/mol, XLogP of 5.08, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[6-(3,5-diethyl-1H-pyrazol-4-yl)hexoxy]phenol is sourced from PubChem (CID 6482622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).