C15H29N3O — CID 64826851
2-(cyclopropylamino)-4-(4-cyclopropylpiperazin-1-yl)-2-methylbutan-1-ol (PubChem CID 64826851) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-(4-cyclopropylpiperazin-1-yl)-2-methylbutan-1-ol.
| Compound Name | 2-(cyclopropylamino)-4-(4-cyclopropylpiperazin-1-yl)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 64826851 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 2-(cyclopropylamino)-4-(4-cyclopropylpiperazin-1-yl)-2-methylbutan-1-ol |
| SMILES | CC(CO)(CCN1CCN(C2CC2)CC1)NC1CC1 |
| InChI | InChI=1S/C15H29N3O/c1-15(12-19,16-13-2-3-13)6-7-17-8-10-18(11-9-17)14-4-5-14/h13-14,16,19H,2-12H2,1H3 |
| InChIKey | ZEJFHXXCZPWFCN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |