C15H32N2O3 — CID 64827377
5-[bis(2-methoxyethyl)amino]-2-(cyclopropylamino)-2-methylpentan-1-ol (PubChem CID 64827377) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-[bis(2-methoxyethyl)amino]-2-(cyclopropylamino)-2-methylpentan-1-ol.
| Compound Name | 5-[bis(2-methoxyethyl)amino]-2-(cyclopropylamino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 64827377 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | 5-[bis(2-methoxyethyl)amino]-2-(cyclopropylamino)-2-methylpentan-1-ol |
| SMILES | COCCN(CCCC(C)(CO)NC1CC1)CCOC |
| InChI | InChI=1S/C15H32N2O3/c1-15(13-18,16-14-5-6-14)7-4-8-17(9-11-19-2)10-12-20-3/h14,16,18H,4-13H2,1-3H3 |
| InChIKey | YLIAJBPQBFNSSL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |