About (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide
(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide (PubChem CID 64828471) has the molecular formula C8H10BF3NO2-
and a molecular weight of 219.98 g/mol. Its IUPAC name is (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide.
Molecular Properties
| Compound Name | (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide |
| PubChem CID | 64828471 |
| Molecular Formula | C8H10BF3NO2- |
| Molecular Weight | 219.98 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide |
| SMILES | CC1(C)C2C(=O)N(C[B-](F)(F)F)C(=O)C21 |
| InChI | InChI=1S/C8H10BF3NO2/c1-8(2)4-5(8)7(15)13(6(4)14)3-9(10,11)12/h4-5H,3H2,1-2H3/q-1 |
| InChIKey | GAMBNVYJHAVZRL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.98 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide?
The IUPAC name of (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide (CID 64828471) is (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide.
What is the SMILES notation for (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide?
The canonical SMILES for (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide is CC1(C)C2C(=O)N(C[B-](F)(F)F)C(=O)C21.
What is the InChIKey of (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide?
The InChIKey is GAMBNVYJHAVZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BF3NO2/c1-8(2)4-5(8)7(15)13(6(4)14)3-9(10,11)12/h4-5H,3H2,1-2H3/q-1.
What are the key properties of (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide?
(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide has a molecular weight of 219.98 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)methyl-trifluoroboranuide is sourced from PubChem (CID 64828471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).