About 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide
2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide (PubChem CID 64828610) has the molecular formula C14H15N5OS
and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide |
| PubChem CID | 64828610 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide |
| SMILES | CC(Nc1cnn(CC(N)=O)c1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H15N5OS/c1-9(10-4-13-12(16-5-10)2-3-21-13)18-11-6-17-19(7-11)8-14(15)20/h2-7,9,18H,8H2,1H3,(H2,15,20) |
| InChIKey | SKIOXAAUPOIDTQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide?
The IUPAC name of 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide (CID 64828610) is 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide.
What is the SMILES notation for 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide?
The canonical SMILES for 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide is CC(Nc1cnn(CC(N)=O)c1)c1cnc2ccsc2c1.
What is the InChIKey of 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide?
The InChIKey is SKIOXAAUPOIDTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5OS/c1-9(10-4-13-12(16-5-10)2-3-21-13)18-11-6-17-19(7-11)8-14(15)20/h2-7,9,18H,8H2,1H3,(H2,15,20).
What are the key properties of 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide?
2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide has a molecular weight of 301.38 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-thieno[3,2-b]pyridin-6-ylethylamino)pyrazol-1-yl]acetamide is sourced from PubChem (CID 64828610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).