C11H18ClN3 — CID 64829137
4-(2-chloropentyl)-N,N-dimethylpyrimidin-2-amine (PubChem CID 64829137) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-(2-chloropentyl)-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4-(2-chloropentyl)-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 64829137 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(2-chloropentyl)-N,N-dimethylpyrimidin-2-amine |
| SMILES | CCCC(Cl)Cc1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C11H18ClN3/c1-4-5-9(12)8-10-6-7-13-11(14-10)15(2)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | XOJPEGGBMOMXQH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|