C24H24N4S — CID 6482920
2-(1-benzothiophen-3-yl)-6-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]pyrazine (PubChem CID 6482920) has the molecular formula C24H24N4S and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-6-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]pyrazine.
| Compound Name | 2-(1-benzothiophen-3-yl)-6-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]pyrazine |
|---|---|
| PubChem CID | 6482920 |
| Molecular Formula | C24H24N4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-6-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]pyrazine |
| SMILES | Cc1cccc(N2CCN(c3cncc(-c4csc5ccccc45)n3)CC2C)c1 |
| InChI | InChI=1S/C24H24N4S/c1-17-6-5-7-19(12-17)28-11-10-27(15-18(28)2)24-14-25-13-22(26-24)21-16-29-23-9-4-3-8-20(21)23/h3-9,12-14,16,18H,10-11,15H2,1-2H3 |
| InChIKey | WYFGXVDNBQKBOC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |