About 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline
2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline (PubChem CID 64829551) has the molecular formula C17H18N2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline.
Molecular Properties
| Compound Name | 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
| PubChem CID | 64829551 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
| SMILES | Cc1ccc(C)c(NC(C)c2cnc3ccsc3c2)c1 |
| InChI | InChI=1S/C17H18N2S/c1-11-4-5-12(2)16(8-11)19-13(3)14-9-17-15(18-10-14)6-7-20-17/h4-10,13,19H,1-3H3 |
| InChIKey | WUXGCYXRMWTTDY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline?
The IUPAC name of 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline (CID 64829551) is 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline.
What is the SMILES notation for 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline?
The canonical SMILES for 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline is Cc1ccc(C)c(NC(C)c2cnc3ccsc3c2)c1.
What is the InChIKey of 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline?
The InChIKey is WUXGCYXRMWTTDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2S/c1-11-4-5-12(2)16(8-11)19-13(3)14-9-17-15(18-10-14)6-7-20-17/h4-10,13,19H,1-3H3.
What are the key properties of 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline?
2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline has a molecular weight of 282.41 g/mol, XLogP of 5.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline is sourced from PubChem (CID 64829551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).