About 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine
4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine (PubChem CID 64829666) has the molecular formula C12H12IN3O
and a molecular weight of 341.15 g/mol. Its IUPAC name is 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine |
| PubChem CID | 64829666 |
| Molecular Formula | C12H12IN3O |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nccc(Oc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C12H12IN3O/c1-16(2)12-14-8-7-11(15-12)17-10-5-3-9(13)4-6-10/h3-8H,1-2H3 |
| InChIKey | WJPBLLXVPONDPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine?
The IUPAC name of 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine (CID 64829666) is 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine.
What is the SMILES notation for 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine?
The canonical SMILES for 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine is CN(C)c1nccc(Oc2ccc(I)cc2)n1.
What is the InChIKey of 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine?
The InChIKey is WJPBLLXVPONDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12IN3O/c1-16(2)12-14-8-7-11(15-12)17-10-5-3-9(13)4-6-10/h3-8H,1-2H3.
What are the key properties of 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine?
4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine has a molecular weight of 341.15 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-iodophenoxy)-N,N-dimethylpyrimidin-2-amine is sourced from PubChem (CID 64829666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).