C14H19N5 — CID 64829706
4-N-[(2-aminophenyl)methyl]-2-N,2-N,4-N-trimethylpyrimidine-2,4-diamine (PubChem CID 64829706) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-N-[(2-aminophenyl)methyl]-2-N,2-N,4-N-trimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(2-aminophenyl)methyl]-2-N,2-N,4-N-trimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 64829706 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-N-[(2-aminophenyl)methyl]-2-N,2-N,4-N-trimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nccc(N(C)Cc2ccccc2N)n1 |
| InChI | InChI=1S/C14H19N5/c1-18(2)14-16-9-8-13(17-14)19(3)10-11-6-4-5-7-12(11)15/h4-9H,10,15H2,1-3H3 |
| InChIKey | JGENDRDXUBEMGI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|