C14H8F5NO2S — CID 6482984
3-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazolidin-4-one (PubChem CID 6482984) has the molecular formula C14H8F5NO2S and a molecular weight of 349.28 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6482984 |
| Molecular Formula | C14H8F5NO2S |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2c(F)c(F)c(F)c(F)c2F)N1Cc1ccco1 |
| InChI | InChI=1S/C14H8F5NO2S/c15-9-8(10(16)12(18)13(19)11(9)17)14-20(7(21)5-23-14)4-6-2-1-3-22-6/h1-3,14H,4-5H2 |
| InChIKey | SCQHBPNLFKZCJP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|