C13H14N4O — CID 64829940
4-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzonitrile (PubChem CID 64829940) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzonitrile.
| Compound Name | 4-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 64829940 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCc2cnn(CCO)c2)cc1 |
| InChI | InChI=1S/C13H14N4O/c14-7-11-1-3-13(4-2-11)15-8-12-9-16-17(10-12)5-6-18/h1-4,9-10,15,18H,5-6,8H2 |
| InChIKey | QVQGQNWXZAWHJG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |