C13H14FN3O3 — CID 64829970
4-fluoro-3-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzoic acid (PubChem CID 64829970) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 4-fluoro-3-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzoic acid.
| Compound Name | 4-fluoro-3-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 64829970 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-fluoro-3-[[1-(2-hydroxyethyl)pyrazol-4-yl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(F)c(NCc2cnn(CCO)c2)c1 |
| InChI | InChI=1S/C13H14FN3O3/c14-11-2-1-10(13(19)20)5-12(11)15-6-9-7-16-17(8-9)3-4-18/h1-2,5,7-8,15,18H,3-4,6H2,(H,19,20) |
| InChIKey | HYCDBMPTCLJZSJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |