About 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine
4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine (PubChem CID 64830311) has the molecular formula C13H21ClN4
and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 64830311 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1nccc(N(CCCl)C2CCCC2)n1 |
| InChI | InChI=1S/C13H21ClN4/c1-17(2)13-15-9-7-12(16-13)18(10-8-14)11-5-3-4-6-11/h7,9,11H,3-6,8,10H2,1-2H3 |
| InChIKey | FWTQGXBOEKBDLH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine (CID 64830311) is 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine is CN(C)c1nccc(N(CCCl)C2CCCC2)n1.
What is the InChIKey of 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The InChIKey is FWTQGXBOEKBDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN4/c1-17(2)13-15-9-7-12(16-13)18(10-8-14)11-5-3-4-6-11/h7,9,11H,3-6,8,10H2,1-2H3.
What are the key properties of 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine?
4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine has a molecular weight of 268.79 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-chloroethyl)-4-N-cyclopentyl-2-N,2-N-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 64830311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).